<- User:Beetstra/listing40 - User:Beetstra/Validation - User:Beetstra/listing42 ->

Data

10001 to 10050

Thallium(I)_oxide (10002)
```
Botcommand: addindex 297685124 Thallium(I)_oxide
```
```
For index : Thallium(I)_oxide=297685124
```
* 1314-12-1 -> 1314-12-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+oxide not found on commonchemistry - Thallium+I+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(I)_sulfate (10003)
```
Botcommand: addindex 325243078 Thallium(I)_sulfate
```
```
For index : Thallium(I)_sulfate=325243078
```
* 7446-18-6 -> 7446-18-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+sulfate not found on commonchemistry - Thallium+I+sulfate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(I)_sulfide (10004)
```
Botcommand: addindex 364628924 Thallium(I)_sulfide
```
```
For index : Thallium(I)_sulfide=364628924
```
* 1314-97-2 -> 1314-97-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+sulfide not found on commonchemistry - Thallium+I+sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(I)_telluride (10005)
```
Botcommand: addindex 286292715 Thallium(I)_telluride
```
```
For index : Thallium(I)_telluride=286292715
```
* 12040-13-0 -> 12040-13-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+telluride not found on commonchemistry - Thallium+I+telluride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(III)_oxide (10006)
```
Botcommand: addindex 361426338 Thallium(III)_oxide
```
```
For index : Thallium(III)_oxide=361426338
```
* 1314-32-5 -> 1314-32-5 - NOT VERIFIED

* CAS found on commonchemistry - 1314-32-5 - name in list
All names: dithallium trioxide, Dithalliumtrioxid, Thallic oxide, Thallium oxide, Thallium oxide (2:3), Thallium oxide (Tl2O3), Thallium sesquioxide, Thallium trioxide, Thallium(3+) oxide, Thallium(III) oxide, trioxido de ditalio, Trioxyde de dithallium, UN 1707

* Thallium+III+oxide not found on commonchemistry - Thallium+III+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thapsigargin (10007)
```
Botcommand: addindex 332015741 Thapsigargin
```
```
For index : Thapsigargin=332015741
```
* 67526-95-8 -> 67526-95-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thapsigargin not found on commonchemistry - Thapsigargin

* No ChemSpiderID (correct: 393753)

* No PubChem

* No InChI

* SMILES: C\C=C(\C)C(=O)O[C@@H]3[C@@H](OC(=O)CCCCCCC)[C@H]1C([C@@H]2OC(=O)[C@](O)(C)[C@@]2(O)[C@H](C[C@]1(C)OC(C)=O)OC(=O)CCC)=C3C
Theaflavin (10008)
```
Botcommand: addindex 350947752 Theaflavin
```
```
For index : Theaflavin=350947752
```
* 4670-05-7 -> 4670-05-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Theaflavin not found on commonchemistry - Theaflavin

* No ChemSpiderID

* PubChem: 114777

* No InChI

* SMILES: C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=O)C(=C4C(=C3)C<br>(=CC(=C4O)O)C5C(CC6=C(C=C(C=C6O5)O)O)O)O)O
Theaflavin_digallate (10009)
```
Botcommand: addindex 364205304 Theaflavin_digallate
```
```
For index : Theaflavin_digallate=364205304
```
* 33377-72-9 -> 33377-72-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Theaflavin+digallate not found on commonchemistry - Theaflavin+digallate

* No ChemSpiderID

* PubChem: 5748168

* No InChI

* SMILES: C1[C@H](C(OC2=CC(=CC(=C21)O)O)C3=CC(=O)C(=C4C(=C3)C(=CC(=C4OC(=O)C5=CC(=C(C(=C5)O)O)O)O)[C@@H]6[C@@H](CC7=C(C=C(C=C7O6)OC(=O)C8=CC(=C(C(=C8)O)O)O)O)O)O)O
Theaflavin-3-gallate (10010)
```
Botcommand: addindex 350941588 Theaflavin-3-gallate
```
```
For index : Theaflavin-3-gallate=350941588
```
* 28543-07-9 -> 28543-07-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Theaflavin+gallate not found on commonchemistry - Theaflavin+gallate

* No ChemSpiderID

* PubChem: 467321

* No InChI

* SMILES: C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=O)C(=C4C(=C3)C(=CC(=C4O)O)[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O
Theanine (10011)
```
Botcommand: addindex 364086759 Theanine
```
```
For index : Theanine=364086759
```
* 3081-61-6 -> 3081-61-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Theanine not found on commonchemistry - Theanine

* ChemSpiderID: 388498 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 228398

* No InChI - (ChemSpider: | InChI=InChI=1/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(NCC)CC[C@H](N)C(=O)O )
Thebacon (10012)
```
Botcommand: addindex 363154313 Thebacon
```
```
For index : Thebacon=363154313
```
* 466-90-0 -> 466-90-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thebacon not found on commonchemistry - Thebacon

* No ChemSpiderID

* PubChem: 10075

* No InChI

* No SMILES
Thenalidine (10014)
```
Botcommand: addindex 337160804 Thenalidine
```
```
For index : Thenalidine=337160804
```
* 86-12-4 -> 86-12-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thenalidine not found on commonchemistry - Thenalidine

* No ChemSpiderID

* PubChem: 27901

* No InChI

* No SMILES
Thenyldiamine (10016)
```
Botcommand: addindex 347457486 Thenyldiamine
```
```
For index : Thenyldiamine=347457486
```
* 91-79-2 -> 91-79-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thenyldiamine not found on commonchemistry - Thenyldiamine

* No ChemSpiderID

* PubChem: 7066

* No InChI

* No SMILES
Theodrenaline (10018)

* No CASNo

* Theodrenaline not found on commonchemistry - Theodrenaline

* No ChemSpiderID

* PubChem: 71857

* No InChI

* No SMILES
Thialbarbital (10020)
```
Botcommand: addindex 359319121 Thialbarbital
```
```
For index : Thialbarbital=359319121
```
* 3546-29-0 -> 3546-29-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thialbarbital not found on commonchemistry - Thialbarbital

* No ChemSpiderID

* PubChem: 3032306

* No InChI

* No SMILES
Thiambutene (10021)

* No CASNo

* Thiambutene not found on commonchemistry - Thiambutene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiamine_monophosphate (10023)
```
Botcommand: addindex 265840231 Thiamine_monophosphate
```
```
For index : Thiamine_monophosphate=265840231
```
* 532-40-1 -> 532-40-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiamine+monophosphate not found on commonchemistry - Thiamine+monophosphate

* No ChemSpiderID

* PubChem: 1131

* No InChI

* No SMILES
Thiamine_triphosphate (10025)
File:ThTP-2D.jpg
```
Botcommand: addindex 328820749 Thiamine_triphosphate
```
```
For index : Thiamine_triphosphate=328820749
```
* 3475-65-8 -> 3475-65-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiamine+triphosphate not found on commonchemistry - Thiamine+triphosphate

* No ChemSpiderID

* PubChem: 18989

* No InChI

* SMILES: CC1=C(SC=[N+]1CC2=CN= C(N=C2N)C)CCOP(=O) (O)OP(=O)(O)OP(=O)(O)[O-]
Thiamphenicol (10026)
```
Botcommand: addindex 364586485 Thiamphenicol
```
```
For index : Thiamphenicol=364586485
```
* 15318-45-3 -> 15318-45-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiamphenicol not found on commonchemistry - Thiamphenicol

* No ChemSpiderID

* PubChem: 27200

* No InChI

* No SMILES
Thiane (10028)

* No CASNo

* Thiane not found on commonchemistry - Thiane

* No ChemSpiderID

* PubChem: 15367

* No InChI

* SMILES: C1CCSCC1
Thiazinamium_metilsulfate (10029)
```
Botcommand: addindex 347457369 Thiazinamium_metilsulfate
```
```
For index : Thiazinamium_metilsulfate=347457369
```
* 2338-21-8 -> 2338-21-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiazinamium+metilsulfate not found on commonchemistry - Thiazinamium+metilsulfate

* No ChemSpiderID

* PubChem: 6016

* No InChI

* No SMILES
Thiazine (10030)

* No CASNo

* Thiazine found on commonchemistry - Thiazine
* 50-52-2 (Formula: C21H26N2S2; Name: 10H-Phenothiazine, 10-[2-(1-methyl-2-piperidinyl)ethyl]-2-(methylthio)-)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 57-68-1 (Formula: C12H14N4O2S; Name: Benzenesulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)-)

* 58-33-3 (Formula: C17H20N2S.ClH; Name: 10H-Phenothiazine-10-ethanamine, N,N,Î±-trimethyl-, monohydrochloride)

* 58-38-8 (Formula: C20H24ClN3S; Name: 10H-Phenothiazine, 2-chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-)

* 58-39-9 (Formula: C21H26ClN3OS; Name: 1-Piperazineethanol, 4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]-)

* 58-40-2 (Formula: C17H20N2S; Name: 10H-Phenothiazine-10-propanamine, N,N-dimethyl-)

* 60-87-7 (Formula: C17H20N2S; Name: 10H-Phenothiazine-10-ethanamine, N,N,Î±-trimethyl-)

* 60-99-1 (Formula: C19H24N2OS; Name: 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,Î²-trimethyl-, (Î²R)-)

* 61-00-7 (Formula: C19H22N2OS; Name: Ethanone, 1-[10-[3-(dimethylamino)propyl]-10H-phenothiazin-2-yl]-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiazolidine (10032)
```
Botcommand: addindex 349493724 Thiazolidine
```
```
For index : Thiazolidine=349493724
```
* 504-78-9 -> 504-78-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiazolidine found on commonchemistry - Thiazolidine
* 96-53-7 (Formula: C3H5NS2; Name: 2-Thiazolidinethione)

* 141-84-4 (Formula: C3H3NOS2; Name: 4-Thiazolidinone, 2-thioxo-)

* 149-30-4 (Formula: C7H5NS2; Name: 2(3H)-Benzothiazolethione)

* 2295-31-0 (Formula: C3H3NO2S; Name: 2,4-Thiazolidinedione)

* 2642-55-9 (Formula: C22H31N3O6S; Name: 4-Thiazolidinecarboxylic acid, 2-[2-[(5-carboxypentyl)amino]-2-oxo-1-[(phenylacetyl)amino]ethyl]-5,5-dimethyl-)

* 111025-46-8 (Formula: C19H20N2O3S; Name: 2,4-Thiazolidinedione, 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-)

* 122320-73-4 (Formula: C18H19N3O3S; Name: 2,4-Thiazolidinedione, 5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]-)

* No ChemSpiderID

* PubChem: 10444

* No InChI

* SMILES: C1CSCN1
Thiazoline (10033)
```
Botcommand: addindex 348762355 Thiazoline
```
```
For index : Thiazoline=348762355
```
* 504-79-0 -> 504-79-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiazoline found on commonchemistry - Thiazoline
* 96-50-4 (Formula: C3H4N2S; Name: 2-Thiazolamine)

* 96-53-7 (Formula: C3H5NS2; Name: 2-Thiazolidinethione)

* 136-95-8 (Formula: C7H6N2S; Name: 2-Benzothiazolamine)

* 149-30-4 (Formula: C7H5NS2; Name: 2(3H)-Benzothiazolethione)

* 2634-33-5 (Formula: C7H5NOS; Name: 1,2-Benzisothiazol-3(2H)-one)

* 2682-20-4 (Formula: C4H5NOS; Name: 3(2H)-Isothiazolone, 2-methyl-)

* 26172-55-4 (Formula: C4H4ClNOS; Name: 3(2H)-Isothiazolone, 5-chloro-2-methyl-)

* 26530-20-1 (Formula: C11H19NOS; Name: 3(2H)-Isothiazolone, 2-octyl-)

* No ChemSpiderID

* PubChem: 120269

* No InChI

* SMILES: C1CSC=N1
Thiazyl_fluoride (10034)
```
Botcommand: addindex 359884093 Thiazyl_fluoride
```
```
For index : Thiazyl_fluoride=359884093
```
* 18820-63-8 -> 18820-63-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiazyl+fluoride not found on commonchemistry - Thiazyl+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiazyl_trifluoride (10035)
```
Botcommand: addindex 359884548 Thiazyl_trifluoride
```
```
For index : Thiazyl_trifluoride=359884548
```
* 15930-75-3 -> 15930-75-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiazyl+trifluoride not found on commonchemistry - Thiazyl+trifluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thienamycin (10036)
```
Botcommand: addindex 320632356 Thienamycin
```
```
For index : Thienamycin=320632356
```
* 59995-64-1 -> 59995-64-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thienamycin found on commonchemistry - Thienamycin
* 64221-86-9 (exact match)
Name in list

All names: [[1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 6-(1-hydroxyethyl)-3-[[2-[(iminomethyl)amino]ethyl]thio]-7-oxo-, [5R-[5Î±,6Î±(R*)]]-]], [[1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 6-[(1R)-1-hydroxyethyl]-3-[[2-[(iminomethyl)amino]ethyl]thio]-7-oxo-, (5R,6S)-]], Imipemide, imipenem, Imipenen, MK 0787, [[N-Formimidoylthienamycin]], Tienamycin

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C1C2CC(=C(N2C1=O)C(=O)O)SCCN)O
Thiepane (10037)

* No CASNo

* Thiepane not found on commonchemistry - Thiepane

* No ChemSpiderID

* PubChem: 78493

* No InChI

* SMILES: C1CCCSCC1
Thiepine (10038)
```
Botcommand: addindex 357382659 Thiepine
```
```
For index : Thiepine=357382659
```
* 291-72-5 -> 291-72-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiepine not found on commonchemistry - Thiepine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1=CC=CSC=C1
Thietane (10039)
```
Botcommand: addindex 348136398 Thietane
```
```
For index : Thietane=348136398
```
* 287-27-4 -> 287-27-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thietane not found on commonchemistry - Thietane

* No ChemSpiderID

* PubChem: 9251

* No InChI

* SMILES: C1CSC1
Thiete (10040)

* No CASNo

* Thiete not found on commonchemistry - Thiete

* No ChemSpiderID

* PubChem: 3415867

* No InChI

* SMILES: C1C=CS1
Thiirene (10043)

* No CASNo

* Thiirene found on commonchemistry - Thiirene
* 420-12-2 (exact match)
Name in list

All names: AETHYLENSULFID, Epithioethan, Epithioethane, epitioetano, Ethylene episulfide, Ethylene sulfide, NSC 89690, Thiacyclopropane, Thiirane, [[thiirene, 2,3-dihydro-]]

* No ChemSpiderID

* PubChem: 5461041

* No InChI

* SMILES: C1=CS1
Thioacetazone (10046)
```
Botcommand: addindex 281055201 Thioacetazone
```
```
For index : Thioacetazone=281055201
```
* 104-06-3 -> 104-06-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioacetazone not found on commonchemistry - Thioacetazone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiobarbital (10048)
```
Botcommand: addindex 359319638 Thiobarbital
```
```
For index : Thiobarbital=359319638
```
* 77-32-7 -> 77-32-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiobarbital found on commonchemistry - Thiobarbital
* 71-73-8 (Formula: C11H18N2O2S.Na; Name: 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-, monosodium salt)

* 76-75-5 (Formula: C11H18N2O2S; Name: 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-)

* No ChemSpiderID

* PubChem: 667509

* No InChI

* No SMILES
Thiobuscaline (10050)
```
Botcommand: addindex 353735240 Thiobuscaline
```
```
For index : Thiobuscaline=353735240
```
* 90109-57-2 -> 90109-57-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiobuscaline not found on commonchemistry - Thiobuscaline

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: COc1cc(cc(OC)c1SCCCC)CCN

10051 to 10100

Thiobutabarbital (10051)
```
Botcommand: addindex 359319910 Thiobutabarbital
```
```
For index : Thiobutabarbital=359319910
```
* 2095-57-0 -> 2095-57-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiobutabarbital not found on commonchemistry - Thiobutabarbital

* No ChemSpiderID

* PubChem: 3032373

* No InChI

* No SMILES
Thiocarlide (10053)
```
Botcommand: addindex 283373233 Thiocarlide
```
```
For index : Thiocarlide=283373233
```
* 910-86-1 -> 910-86-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiocarlide not found on commonchemistry - Thiocarlide

* No ChemSpiderID

* PubChem: 3001386

* No InChI

* No SMILES
Thiocolchicoside (10054)
```
Botcommand: addindex 354704852 Thiocolchicoside
```
```
For index : Thiocolchicoside=354704852
```
* 602-41-5 -> 602-41-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiocolchicoside not found on commonchemistry - Thiocolchicoside

* No ChemSpiderID

* PubChem: 72067

* No InChI

* No SMILES
Thiocyanate (10055)

* No CASNo

* Thiocyanate found on commonchemistry - Thiocyanate
* 302-04-5 (Formula: CNS; Name: Thiocyanate)

* 57-06-7 (Formula: C4H5NS; Name: 1-Propene, 3-isothiocyanato-)

* 103-72-0 (Formula: C7H5NS; Name: Benzene, isothiocyanato-)

* 333-20-0 (Formula: CHNS.K; Name: Thiocyanic acid, potassium salt)

* 463-56-9 (Formula: CHNS; Name: Thiocyanic acid)

* 532-55-8 (Formula: C8H5NOS; Name: Benzoyl isothiocyanate)

* 540-72-7 (Formula: CHNS.Na; Name: Thiocyanic acid, sodium salt)

* 542-85-8 (Formula: C3H5NS; Name: Ethane, isothiocyanato-)

* 556-61-6 (Formula: C2H3NS; Name: Methane, isothiocyanato-)

* 622-59-3 (Formula: C8H7NS; Name: Benzene, 1-isothiocyanato-4-methyl-)

* No ChemSpiderID

* PubChem: 9322

* No InChI

* SMILES: C(#N)[S-]
Thiocyanogen (10057)
```
Botcommand: addindex 321012932 Thiocyanogen
```
```
For index : Thiocyanogen=321012932
```
* 505-14-6 -> 505-14-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiocyanogen not found on commonchemistry - Thiocyanogen

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiofentanyl (10059)
```
Botcommand: addindex 344100093 Thiofentanyl
```
```
For index : Thiofentanyl=344100093
```
* 60771-38-2 -> 60771-38-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiofentanyl not found on commonchemistry - Thiofentanyl

* No ChemSpiderID

* PubChem: 62380

* No InChI

* No SMILES
Thioflavin (10060)
```
Botcommand: addindex 321801904 Thioflavin
```
```
For index : Thioflavin=321801904
```
* 2390-54-7 -> 2390-54-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioflavin not found on commonchemistry - Thioflavin

* No ChemSpiderID

* PubChem: 16953

* No InChI

* SMILES: CC1=CC2=C(C=C1)[N+](=C(S2)<br />C3=CC=C(C=C3)N(C)C)C.[Cl-]
Thioinosinic_acid (10062)
```
Botcommand: addindex 265872750 Thioinosinic_acid
```
```
For index : Thioinosinic_acid=265872750
```
* 53-83-8 -> 53-83-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioinosinic+acid not found on commonchemistry - Thioinosinic+acid

* No ChemSpiderID

* PubChem: 3034391

* No InChI

* SMILES: O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2NC=NC3=S)O[C@@H]1COP(O)(O)=O
Thiolutin (10063)
```
Botcommand: addindex 309462907 Thiolutin
```
```
For index : Thiolutin=309462907
```
* 87-11-6 -> 87-11-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiolutin not found on commonchemistry - Thiolutin

* No ChemSpiderID

* PubChem: 6870

* No InChI

* No SMILES
Thiomalic_acid (10064)

* No CASNo

* Thiomalic+acid found on commonchemistry - Thiomalic+acid
* 70-49-5 (exact match)
Name in list

All names: (.+-.)-Mercaptosuccinic acid, 2-Mercaptosuccinic acid, [[2-thiomalic acid]], Acide mercaptosuccinique, acido mercaptosuccinico, Butanedioic acid, 2-mercapto-, Butanedioic acid, mercapto-, DL-Mercaptosuccinic acid, [[DL-thiomalic acid]], Mercaptobernsteinsaure, Mercaptobutanedioic acid, Mercaptobutanedoic acid, mercaptosuccinic acid, Monomercaptosuccinic acid, NSC 7302, Succinic acid, mercapto-, THIOAPFELSAEURE, [[thiomalic acid]], Î±-Mercaptosuccinic acid

* ChemSpiderID: 6032 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6268

* No InChI - (ChemSpider: | InChI=InChI=1/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8) )

* No SMILES - (ChemSpider: | SMILES=O=C(O)CC(S)C(=O)O )
Thiomethisosildenafil (10066)

* No CASNo

* Thiomethisosildenafil not found on commonchemistry - Thiomethisosildenafil

* No ChemSpiderID

* PubChem: 23139635

* No InChI

* No SMILES
Thionine (10068)

* No CASNo

* Thionine found on commonchemistry - Thionine
* 581-64-6 (Formula: C12H10N3S.Cl; Name: Phenothiazin-5-ium, 3,7-diamino-, chloride)

* 56-88-2 (Formula: C7H14N2O4S; Name: L-Homocysteine, S-[(2R)-2-amino-2-carboxyethyl]-)

* 59-51-8 (Formula: C5H11NO2S; Name: Methionine)

* 61-73-4 (Formula: C16H18N3S.Cl; Name: Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride)

* 63-68-3 (Formula: C5H11NO2S; Name: L-Methionine)

* 122-14-5 (Formula: C9H12NO5PS; Name: Phosphorothioic acid, O,O-dimethylO-(3-methyl-4-nitrophenyl) ester)

* 348-67-4 (Formula: C5H11NO2S; Name: D-Methionine)

* 1464-42-2 (Formula: C5H11NO2Se; Name: Butanoic acid, 2-amino-4-(methylseleno)-)

* 7005-18-7 (Formula: ; Name: Methionine)

* 9012-25-3 (Formula: Unspecified; Name: Methyltransferase, catechol)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thionyl_bromide (10069)
```
Botcommand: addindex 355391153 Thionyl_bromide
```
```
For index : Thionyl_bromide=355391153
```
* 507-16-4 -> 507-16-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thionyl+bromide not found on commonchemistry - Thionyl+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=S(Br)Br
Thionyl_fluoride (10071)
```
Botcommand: addindex 355383715 Thionyl_fluoride
```
```
For index : Thionyl_fluoride=355383715
```
* 7783-42-8 -> 7783-42-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Thionyl+fluoride not found on commonchemistry - Thionyl+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thioperamide (10072)
```
Botcommand: addindex 360227099 Thioperamide
```
```
For index : Thioperamide=360227099
```
* 106243-16-7 -> 106243-16-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioperamide not found on commonchemistry - Thioperamide

* No ChemSpiderID

* PubChem: 3035905

* No InChI

* No SMILES
Thiophosphoryl_chloride (10076)
```
Botcommand: addindex 323247658 Thiophosphoryl_chloride
```
```
For index : Thiophosphoryl_chloride=323247658
```
* 3982-91-0 -> 3982-91-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiophosphoryl+chloride not found on commonchemistry - Thiophosphoryl+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thiopropazate (10077)
```
Botcommand: addindex 346033457 Thiopropazate
```
```
For index : Thiopropazate=346033457
```
* 84-06-0 -> 84-06-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiopropazate not found on commonchemistry - Thiopropazate

* ChemSpiderID: 6504 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6762

* No InChI - (ChemSpider: | InChI=InChI=1/C23H28ClN3O2S/c1-18(28)29-16-15-26-13-11-25(12-14-26)9-4-10-27-20-5-2-3-6-22(20)30-23-8-7-19(24)17-21(23)27/h2-3,5-8,17H,4,9-16H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O=C(OCCN1CCN(CC1)CCCN2c4c(Sc3c2cc(Cl)cc3)cccc4)C )
Thioproscaline (10079)
```
Botcommand: addindex 349766412 Thioproscaline
```
```
For index : Thioproscaline=349766412
```
* 90109-55-0 -> 90109-55-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioproscaline not found on commonchemistry - Thioproscaline

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: COc1cc(cc(OC)c1SCCC)CCN
Thiopyran (10080)

* No CASNo

* Thiopyran found on commonchemistry - Thiopyran
* 118292-40-3 (Formula: C21H21NO2S; Name: 3-Pyridinecarboxylic acid, 6-[(3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran-6-yl)ethynyl]-, ethyl ester)

* 120279-96-1 (Formula: C10H16N2O4S3; Name: 4H-Thieno[2,3-b]thiopyran-2-sulfonamide, 4-(ethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4S,6S)-)

* No ChemSpiderID

* PubChem: 11344401

* No InChI

* SMILES: C1=CC=[S+]C=C1
Thiorphan (10082)
```
Botcommand: addindex 349594876 Thiorphan
```
```
For index : Thiorphan=349594876
```
* 76721-89-6 -> 76721-89-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiorphan not found on commonchemistry - Thiorphan

* ChemSpiderID: 3020 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3132

* No InChI - (ChemSpider: | InChI=InChI=1/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) )

* No SMILES - (ChemSpider: | smiles=O=C(O)CNC(=O)C(CS)Cc1ccccc1 )
Thiostrepton (10083)
```
Botcommand: addindex 354360903 Thiostrepton
```
```
For index : Thiostrepton=354360903
```
* 1393-48-2 -> 1393-48-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiostrepton not found on commonchemistry - Thiostrepton

* No ChemSpiderID

* PubChem: 16130278

* No InChI

* SMILES: C[C@@H](O)[C@@](C)(O)[C@@H](C2=NC6=CS2)NC(C1CSC(/C(NC([C@@H](NC(C3=CS[C@]([C@]4(NC([C@@H](NC(C(NC([C@H](C)NC%10=O)=O)=C)=O)C)=O)C(C5=CSC([C@H]([C@@H](C)OC(C8=CC([C@H](C)O)=C(C=CC(N[C@]([H])%10[C@H](CC)C)[C@@H]9O)C9=N8)=O)NC6=O)=N5)N=C(C7=NC(C(NC(C(NC(C(N)=O)=C)=O)=C)=O)=CS7)CC4)=N3)=O)[C@@H](C)O)=O)=C/C)=N1)=O
Thiosulfuric_acid (10084)
File:ThioschwefelsÃ¤ure.svg
```
Botcommand: addindex 360871270 Thiosulfuric_acid
```
```
For index : Thiosulfuric_acid=360871270
```
* 13686-28-7 -> 13686-28-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thiosulfuric+acid found on commonchemistry - Thiosulfuric+acid
* 7772-98-7 (Formula: H2O3S2.2Na; Name: Thiosulfuric acid, (H2S2O3), disodium salt)

* 7783-18-8 (Formula: H3N.1/2H2O3S2; Name: Thiosulfuric acid, (H2S2O3), diammonium salt)

* 10102-17-7 (Formula: H2O3S2.5H2O.2Na; Name: Thiosulfuric acid, (H2S2O3), disodium salt, pentahydrate)

* No ChemSpiderID

* PubChem: 24478

* InChI: 1/H2O3S2/c1-5(2,3)4/h(H2,1,2,3,4)

* No SMILES
Thioxanthene (10088)
```
Botcommand: addindex 343292805 Thioxanthene
```
```
For index : Thioxanthene=343292805
```
* 261-31-4 -> 261-31-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thioxanthene found on commonchemistry - Thioxanthene
* 113-59-7 (Formula: C18H18ClNS; Name: 1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, (3Z)-)

* 2709-56-0 (Formula: C23H25F3N2OS; Name: 1-Piperazineethanol, 4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-)

* 4969-02-2 (Formula: C20H23NS; Name: Piperidine, 1-methyl-3-(9H-thioxanthen-9-ylmethyl)-)

* 5591-45-7 (Formula: C23H29N3O2S2; Name: 9H-Thioxanthene-2-sulfonamide, N,N-dimethyl-9-[3-(4-methyl-1-piperazinyl)propylidene]-)

* No ChemSpiderID

* PubChem: 67495

* No InChI

* SMILES: C1C2=CC=CC=C2SC3=CC=CC=C31
Thonzylamine (10090)
```
Botcommand: addindex 347187298 Thonzylamine
```
```
For index : Thonzylamine=347187298
```
* 91-85-0 -> 91-85-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thonzylamine not found on commonchemistry - Thonzylamine

* No ChemSpiderID

* PubChem: 5457

* No InChI

* No SMILES
Thorin_(chemistry) (10091)
```
Botcommand: addindex 356738338 Thorin_(chemistry)
```
```
For index : Thorin_(chemistry)=356738338
```
* 3688-92-4 -> 3688-92-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorin+chemistry not found on commonchemistry - Thorin+chemistry

* No ChemSpiderID

* PubChem: 6537679

* No InChI

* SMILES: [Na+].[Na+].O[As](O)(=O)c3ccccc3/N=N/c1c2 ccc(cc2cc(c1O)S([O-])(=O)=O)S([O-])(=O)=O
Thorium(IV)_carbide (10093)
File:Thorium(IV) carbide.jpg
```
Botcommand: addindex 351184644 Thorium(IV)_carbide
```
```
For index : Thorium(IV)_carbide=351184644
```
* 12012-16-7 -> 12012-16-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorium+IV+carbide not found on commonchemistry - Thorium+IV+carbide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thorium(IV)_chloride (10094)
File:Thorium(IV) chloride.jpg
```
Botcommand: addindex 351184622 Thorium(IV)_chloride
```
```
For index : Thorium(IV)_chloride=351184622
```
* 10026-08-1 -> 10026-08-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorium+IV+chloride not found on commonchemistry - Thorium+IV+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thorium(IV)_iodide (10096)
```
Botcommand: addindex 351182256 Thorium(IV)_iodide
```
```
For index : Thorium(IV)_iodide=351182256
```
* 7790-49-0 -> 7790-49-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorium+IV+iodide not found on commonchemistry - Thorium+IV+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thorium(IV)_orthosilicate (10097)
File:Thorium(IV) orthosilicate.jpg
```
Botcommand: addindex 265814123 Thorium(IV)_orthosilicate
```
```
For index : Thorium(IV)_orthosilicate=265814123
```
* 14553-44-7 -> 14553-44-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorium+IV+orthosilicate not found on commonchemistry - Thorium+IV+orthosilicate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thorium(IV)_sulfide (10098)
File:Thorium(IV) sulfide.jpg
```
Botcommand: addindex 351187622 Thorium(IV)_sulfide
```
```
For index : Thorium(IV)_sulfide=351187622
```
* 12138-07-7 -> 12138-07-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thorium+IV+sulfide not found on commonchemistry - Thorium+IV+sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thozalinone (10099)
File:(Â±)-thozalinone enantiomers structural formulae.png
```
Botcommand: addindex 360481067 Thozalinone
```
```
For index : Thozalinone=360481067
```
* 655-05-0 -> 655-05-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thozalinone not found on commonchemistry - Thozalinone

* No ChemSpiderID

* PubChem: 12602

* No InChI

* No SMILES
Threitol (10100)
```
Botcommand: addindex 325490582 Threitol
```
```
For index : Threitol=325490582
```
* 2418-52-2 -> 2418-52-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Threitol found on commonchemistry - Threitol
* 3483-12-3 (exact match)
Name in list

All names: (.+-.)-1,4-Dimercapto-2,3-butanediol, [[(.+-.)-Dithiothreitol]], (R*,R*)-1,4-Dimercaptobutan-2,3-diol, (R*,R*)-1,4-Dimercaptobutane-2,3-diol, (R*,R*)-1,4-dimercaptobutano-2,3-diol, [[1,4-Dithio-DL-threitol]], [[1,4-Dithiothreitol]], 2,3-Butanediol, 1,4-dimercapto-, (2R,3R)-rel-, 2,3-Butanediol, 1,4-dimercapto-, (R*,R*)-, CLELANDS REAGENT, Cleland's reagent, [[Dithiothreitol]], DL-1,4-Dimercapto-2,3-dihydroxybutane, [[DL-1,4-Dithiothreitol]], [[DL-Dithiothreitol]], DTT, [[DTT (threitol derivative)]], [[rac-Dithiothreitol]], Reagents, Cleland's, Sputolysin, [[threitol, 1,4-dithio-]], threo-1,4-Dimercapto-2,3-butanediol, threo-2,3-Dihydroxy-1,4-butanedithiol, threo-2,3-Dihydroxy-1,4-dithiolbutane, WR 34678

* No ChemSpiderID

* PubChem: 169019

* No InChI

* SMILES: C(C(C(CO)O)O)O

10101 to 10150

Threonic_acid (10101)
```
Botcommand: addindex 356386226 Threonic_acid
```
```
For index : Threonic_acid=356386226
```
* 3909-12-4 -> 3909-12-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Threonic+acid not found on commonchemistry - Threonic+acid

* No ChemSpiderID

* PubChem: 5460407

* No InChI

* SMILES: OC([C@H](O)[C@@H](O)CO)=O
Threose (10103)
```
Botcommand: addindex 355285861 Threose
```
```
For index : Threose=355285861
```
* 95-43-2 -> 95-43-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Threose not found on commonchemistry - Threose

* No ChemSpiderID

* PubChem: 439665

* No InChI

* SMILES: OC[C@@H](O)[C@H](O)C=O
Thromboxane_A2 (10104)
```
Botcommand: addindex 359977313 Thromboxane_A2
```
```
For index : Thromboxane_A2=359977313
```
* 57576-52-0 -> 57576-52-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Thromboxane+A not found on commonchemistry - Thromboxane+A

* No ChemSpiderID

* PubChem: 5280497

* No InChI

* No SMILES
Thromboxane_B2 (10105)
```
Botcommand: addindex 277681217 Thromboxane_B2
```
```
For index : Thromboxane_B2=277681217
```
* 54397-85-2 -> 54397-85-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thromboxane+B not found on commonchemistry - Thromboxane+B

* No ChemSpiderID

* PubChem: 5283137

* No InChI

* No SMILES
Thujone (10107)
```
Botcommand: addindex 364650076 Thujone
```
```
For index : Thujone=364650076
```
* 471-15-8 -> 471-15-8 - NOT VERIFIED

* CAS found on commonchemistry - 471-15-8 - name in list
All names: (+)-Isothujone, (+)-Thujone, (+)-Î²-Thujone, 3-Thujanone, (1S,4S,5R)-(+)-, BETA-THUJON, [[Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-, (1S,4S,5R)-]], [[Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-, [1S-(1Î±,4Î²,5Î±)]-]], cis-Thujone, d-Isothujone, d-Î²-Thujone, Isothujone, NSC 67392, Thujone, (+)-, Î²-Thujone

* Thujone found on commonchemistry - Thujone
* 546-80-5 (Formula: C10H16O; Name: Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-, (1S,4R,5R)-)

* 471-15-8 (Formula: C10H16O; Name: Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-, (1S,4S,5R)-) Matches CAS (471-15-8) on page

* No ChemSpiderID

* PubChem: 261491

* No InChI

* SMILES: C[C@@H]([C@@H](C2)[C@]2([C@@H](C)C)C1)C1=O (ÃŽÂ²-thujone)
Thulium(III)_chloride (10108)
```
Botcommand: addindex 301334808 Thulium(III)_chloride
```
```
For index : Thulium(III)_chloride=301334808
```
* 13537-18-3 -> 13537-18-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Thulium+III+chloride not found on commonchemistry - Thulium+III+chloride

* No ChemSpiderID

* PubChem: 24867527

* No InChI

* No SMILES
Thymectacin (10110)
```
Botcommand: addindex 326759966 Thymectacin
```
```
For index : Thymectacin=326759966
```
* 232925-18-7 -> 232925-18-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thymectacin not found on commonchemistry - Thymectacin

* No ChemSpiderID

* PubChem: 6440764

* No InChI

* No SMILES
Thymidine_diphosphate (10112)
```
Botcommand: addindex 363419010 Thymidine_diphosphate
```
```
For index : Thymidine_diphosphate=363419010
```
* 1861-44-5 -> 1861-44-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Thymidine+diphosphate not found on commonchemistry - Thymidine+diphosphate

* No ChemSpiderID

* PubChem: 164628

* No InChI

* SMILES: CC1=CN(C(=O)NC1=O)[C@H]2C [C@@H]([C@H](O2)COP(=O)(O)OP (=O)(O)O)O
Thymidine_diphosphate_glucose (10113)

* No CASNo

* Thymidine+diphosphate+glucose not found on commonchemistry - Thymidine+diphosphate+glucose

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thymidine_monophosphate (10114)
```
Botcommand: addindex 350301804 Thymidine_monophosphate
```
```
For index : Thymidine_monophosphate=350301804
```
* 365-07-1 -> 365-07-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thymidine+monophosphate found on commonchemistry - Thymidine+monophosphate
* 9027-73-0 (exact match)
Name in list

All names: 224: PN: US20040180038 PAGE: 35 claimed sequence, 5'-Adenylic phosphatase, 5'-AMP nucleotidase, 5'-AMPase, 5'-Mononucleotidase, 5'-Nucleotidase, 5-Nucleotidase, Adenosine 5'-monophosphatase, Adenosine 5'-phosphatase, Adenosine monophosphatase, Adenylate 5'-nucleotidase, AMP phosphatase, AMP phosphohydrolase, AMPase, CD antigens, CD73, CD73, E.C. 3.1.3.5, Ecto-5'-nucleotidase, Ectonucleotidase, IMP 5'-nucleotidase, IMP-GMP 5'-nucleotidase, nucleotidasa, 5'-, Nucleotidase, 5'-, nucleotidase-5', Nucleotide phosphomonoesterase, Snake venom 5'-nucleotidase, [[thymidine monophosphate nucleotidase]], Thymidylate 5'-nucleotidase, Thymidylate 5'-phosphatase, TMP 5'-nucleotidase, UMP phosphohydrolase, UMPase, Uridine 5'-nucleotidase, Uridine-5'-monophosphate phosphohydrolase, Uridylate phosphatase

* No ChemSpiderID

* PubChem: 1139

* No InChI

* No SMILES
Thymidine_triphosphate (10115)
```
Botcommand: addindex 354329023 Thymidine_triphosphate
```
```
For index : Thymidine_triphosphate=354329023
```
* 365-08-2 -> 365-08-2 - NOT VERIFIED

* CAS found on commonchemistry - 365-08-2 - name in list
All names: 2'-Deoxythymidine 5'-triphosphate, 2'-Deoxythymidine triphosphate, 5'-(tetrahidrogenotrifosfato) de timidina, 5'-(tetrahydrogenotriphosphate) de thymidine, 5-Methyl-dUTP, 5'-TTP, Deoxythymidine 5'-triphosphate, Deoxythymidine triphosphate, Deoxy-TTP, dTTP, Thymidin-5'-(tetrahydrogentriphosphat), thymidine 5'-(tetrahydrogen triphosphate), Thymidine 5'-triphosphate, Thymidine triphosphate, Thymidine, mono(tetrahydrogen triphosphate) (ester), TTP, TTP (nucleotide)

* Thymidine+triphosphate found on commonchemistry - Thymidine+triphosphate
* 365-08-2 (exact match) Matches CAS (365-08-2) on page
Name in list

All names: 2'-Deoxythymidine 5'-triphosphate, [[2'-Deoxythymidine triphosphate]], 5'-(tetrahidrogenotrifosfato) de timidina, 5'-(tetrahydrogenotriphosphate) de thymidine, 5-Methyl-dUTP, 5'-TTP, Deoxythymidine 5'-triphosphate, [[Deoxythymidine triphosphate]], Deoxy-TTP, dTTP, Thymidin-5'-(tetrahydrogentriphosphat), thymidine 5'-(tetrahydrogen triphosphate), Thymidine 5'-triphosphate, [[thymidine triphosphate]], Thymidine, mono(tetrahydrogen triphosphate) (ester), TTP, TTP (nucleotide)

* No ChemSpiderID

* PubChem: 1151

* No InChI

* No SMILES
Thymol_blue (10118)
```
Botcommand: addindex 359460095 Thymol_blue
```
```
For index : Thymol_blue=359460095
```
* 76-59-5 -> 76-59-5 - NOT VERIFIED

* CAS found on commonchemistry - 76-59-5 - name in list
All names: 3,3'-Dibromothymolsulfonphthalein, 3,3'-Dibromothymolsulfophthalein, [[4,4'-(3H-2,1-Benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)phenol]-S,S-dioxide]], azul de bromotimol, Bleu de bromothymol, bromothymol blue, Bromthymol blue, BROMTHYMOL BLUE SULFONE FORM, Bromthymolblau, Dibromothymolsulfophthalein, NSC 7819, [[Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-]], [[PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS [2-BROMO-3-METHYL-6-(1-METHYLETHYL)-, S,S-DIOXIDE]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-, S,S-dioxide]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-, S,S-dioxide]], [[Thymol, 6,6'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-, S,S-dioxide]]

* Thymol+blue found on commonchemistry - Thymol+blue
* 76-59-5 (exact match) Matches CAS (76-59-5) on page
Name in list

All names: 3,3'-Dibromothymolsulfonphthalein, 3,3'-Dibromothymolsulfophthalein, [[4,4'-(3H-2,1-Benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)phenol]-S,S-dioxide]], azul de bromotimol, Bleu de bromothymol, [[bromothymol blue]], [[Bromthymol blue]], [[BROMthymol blue SULFONE FORM]], Bromthymolblau, Dibromothymolsulfophthalein, NSC 7819, [[Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-]], [[PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS [2-BROMO-3-METHYL-6-(1-METHYLETHYL)-, S,S-DIOXIDE]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-, S,S-dioxide]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)-, S,S-dioxide]], [[Thymol, 6,6'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-, S,S-dioxide]]

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: c1cc2S(OC(c2cc1)(c1c(cc(c(c1)C(C)C)O)C)c1cc(c(cc1C)O)C(C)C)(=O)=O
Thymolphthalein (10119)
```
Botcommand: addindex 349807547 Thymolphthalein
```
```
For index : Thymolphthalein=349807547
```
* 125-20-2 -> 125-20-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Thymolphthalein not found on commonchemistry - Thymolphthalein

* No ChemSpiderID

* PubChem: 31316

* No InChI

* SMILES: CC(C)c1cc(c(C)cc1O)C2(OC(=O)c3ccccc23)c4cc(C(C)C)c(O)cc4C
Thymopentin (10120)
* No CASNo

* Thymopentin not found on commonchemistry - Thymopentin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thymoquinone (10121)
```
Botcommand: addindex 355935017 Thymoquinone
```
```
For index : Thymoquinone=355935017
```
* 490-91-5 -> 490-91-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Thymoquinone not found on commonchemistry - Thymoquinone

* No ChemSpiderID

* PubChem: 10281

* No InChI

* SMILES: CC1=CC(=O)C(=CC1=O)C(C)C
Thymulin (10122)

* No CASNo

* Thymulin not found on commonchemistry - Thymulin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thyronamine (10123)
```
Botcommand: addindex 332222932 Thyronamine
```
```
For index : Thyronamine=332222932
```
* 500-78-7 -> 500-78-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thyronamine not found on commonchemistry - Thyronamine

* No ChemSpiderID

* PubChem: 3083601

* No InChI

* No SMILES
Thyronine (10124)
```
Botcommand: addindex 302457383 Thyronine
```
```
For index : Thyronine=302457383
```
* 1596-67-4 -> 1596-67-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Thyronine found on commonchemistry - Thyronine
* 51-48-9 (Formula: C15H11I4NO4; Name: L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-)

* 51-49-0 (Formula: C15H11I4NO4; Name: D-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-)

* 3130-96-9 (Formula: C15H12I3NO4; Name: Tyrosine, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-)

* 6893-02-3 (Formula: C15H12I3NO4; Name: L-Tyrosine, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-)

* No ChemSpiderID

* PubChem: 5461103

* No InChI

* SMILES: C1=CC(=CC=C1C[C@@H](C(=O)O)N)OC2=CC=C(C=C2)O
Thyroxine (10125)
```
Botcommand: addindex 360443333 Thyroxine
```
```
For index : Thyroxine=360443333
```
* 51-48-9 -> 51-48-9 - NOT VERIFIED

* CAS found on commonchemistry - 51-48-9 - name in list
All names: (-)-Thyroxine, 3,3',5,5'-Tetraiodo-L-thyronine, DL-thyroxin, DL-thyroxine, DL-tiroxina, Henning, L-3,5,3'5'-Tetraiodothyronine, Levothyroxine, L-T4, L-Thyroxin, L-Thyroxine, L-Thyroxine, L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-, NSC 36397, T4, T4 (hormone), Tetraiodothyronine, THX, Thyrax, Thyreoideum, Thyroxin, Thyroxinal, Thyroxine, Thyroxine, L-

* Thyroxine found on commonchemistry - Thyroxine
* 51-48-9 (Formula: C15H11I4NO4; Name: L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-) Matches CAS (51-48-9) on page

* 51-49-0 (Formula: C15H11I4NO4; Name: D-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-)

* No ChemSpiderID

* PubChem: 5819

* No InChI

* SMILES: NC(Cc1cc(I)c(Oc2cc(I)c(O)<br />c(I)c2)c(I)c1)C(O)=O
Tiadenol (10127)
```
Botcommand: addindex 345879888 Tiadenol
```
```
For index : Tiadenol=345879888
```
* 6964-20-1 -> 6964-20-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiadenol not found on commonchemistry - Tiadenol

* No ChemSpiderID

* PubChem: 23403

* No InChI

* No SMILES
Tiamenidine (10129)

* No CASNo

* Tiamenidine not found on commonchemistry - Tiamenidine

* ChemSpiderID: 36548 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 39974

* No InChI - (ChemSpider: | InChI=InChI=1/C8H10ClN3S/c1-5-4-13-7(9)6(5)12-8-10-2-3-11-8/h4H,2-3H2,1H3,(H2,10,11,12) )

* No SMILES - (ChemSpider: | smiles=Clc2scc(c2N/C1=N/CCN1)C )
Tiamulin (10130)
```
Botcommand: addindex 355758640 Tiamulin
```
```
For index : Tiamulin=355758640
```
* 55297-95-5 -> 55297-95-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiamulin not found on commonchemistry - Tiamulin

* No ChemSpiderID

* PubChem: 656958

* No InChI

* No SMILES
Tianeptine (10131)
```
Botcommand: addindex 364819142 Tianeptine
```
```
For index : Tianeptine=364819142
```
* 66981-73-5 -> 66981-73-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tianeptine not found on commonchemistry - Tianeptine

* No ChemSpiderID

* PubChem: 68870

* No InChI

* No SMILES
Tiapamil (10132)
```
Botcommand: addindex 358274358 Tiapamil
```
```
For index : Tiapamil=358274358
```
* 67418-30-8 -> 67418-30-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiapamil not found on commonchemistry - Tiapamil

* ChemSpiderID: 38399 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 42107

* No InChI - (ChemSpider: | InChI=InChI=1/C26H37NO8S2/c1-27(15-12-20-8-10-22(32-2)24(18-20)34-4)14-6-13-26(36(28,29)16-7-17-37(26,30)31)21-9-11-23(33-3)25(19-21)35-5/h8-11,18-19H,6-7,12-17H2,1-5H3 )

* No SMILES - (ChemSpider: | smiles=O=S3(=O)CCCS(=O)(=O)C3(c1ccc(OC)c(OC)c1)CCCN(CCc2ccc(OC)c(OC)c2)C )
Tiapride (10133)
```
Botcommand: addindex 347180491 Tiapride
```
```
For index : Tiapride=347180491
```
* 51012-32-9 -> 51012-32-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiapride not found on commonchemistry - Tiapride

* ChemSpiderID: 5268 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5467

* No InChI - (ChemSpider: | InChI=InChI=1/C15H24N2O4S/c1-5-17(6-2)10-9-16-15(18)13-11-12(22(4,19)20)7-8-14(13)21-3/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18) )

* No SMILES - (ChemSpider: | smiles=O=S(=O)(c1ccc(OC)c(C(=O)NCCN(CC)CC)c1)C )
Tiazofurin (10135)
```
Botcommand: addindex 290503782 Tiazofurin
```
```
For index : Tiazofurin=290503782
```
* 60084-10-8 -> 60084-10-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiazofurin not found on commonchemistry - Tiazofurin

* No ChemSpiderID

* PubChem: 457954

* No InChI

* No SMILES
Tibezonium_iodide (10136)

* No CASNo

* Tibezonium+iodide not found on commonchemistry - Tibezonium+iodide

* No ChemSpiderID

* PubChem: 41157

* No InChI

* No SMILES
Tibolone (10137)
```
Botcommand: addindex 345744039 Tibolone
```
```
For index : Tibolone=345744039
```
* 5630-53-5 -> 5630-53-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tibolone not found on commonchemistry - Tibolone

* No ChemSpiderID

* PubChem: 21844

* No InChI

* No SMILES
Ticagrelor (10138)
```
Botcommand: addindex 364238864 Ticagrelor
```
```
For index : Ticagrelor=364238864
```
* 274693-27-5 -> 274693-27-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ticagrelor not found on commonchemistry - Ticagrelor

* No ChemSpiderID

* PubChem: 9871419

* No InChI

* No SMILES
Tick-borne_encephalitis_vaccine (10140)
* No CASNo

* Tick+borne+encephalitis+vaccine not found on commonchemistry - Tick+borne+encephalitis+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ticlatone (10141)
```
Botcommand: addindex 360145637 Ticlatone
```
```
For index : Ticlatone=360145637
```
* 70-10-0 -> 70-10-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ticlatone not found on commonchemistry - Ticlatone

* No ChemSpiderID

* PubChem: 6258

* No InChI

* No SMILES
Tidiacic (10143)
```
Botcommand: addindex 343030792 Tidiacic
```
```
For index : Tidiacic=343030792
```
* 30097-06-4 -> 30097-06-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tidiacic not found on commonchemistry - Tidiacic

* No ChemSpiderID

* PubChem: 72150

* No InChI

* No SMILES
Tidiacic_arginine (10144)
```
Botcommand: addindex 343030678 Tidiacic_arginine
```
```
For index : Tidiacic_arginine=343030678
```
* 30986-62-0 -> 30986-62-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tidiacic+arginine not found on commonchemistry - Tidiacic+arginine

* ChemSpiderID: 142008 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C6H14N4O2.C5H7NO4S/c7-4(5(11)12)2-1-3-10-6(8)9;7-4(8)2-1-11-3(6-2)5(9)10/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-3,6H,1H2,(H,7,8)(H,9,10)/t4-;/m0./s1 )

* No SMILES - (ChemSpider: | smiles=O=C(O)C1SCC(C(=O)O)N1.O=C(O)[C@@H](N)CCC/N=C(\N)N )
Tiemonium_iodide (10145)
```
Botcommand: addindex 348545326 Tiemonium_iodide
```
```
For index : Tiemonium_iodide=348545326
```
* 144-12-7 -> 144-12-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiemonium+iodide not found on commonchemistry - Tiemonium+iodide

* No ChemSpiderID

* PubChem: 72142

* No InChI

* No SMILES
Tienilic_acid (10146)
```
Botcommand: addindex 350103335 Tienilic_acid
```
```
For index : Tienilic_acid=350103335
```
* 40180-04-9 -> 40180-04-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tienilic+acid not found on commonchemistry - Tienilic+acid

* No ChemSpiderID

* PubChem: 38409

* No InChI

* No SMILES
Tienopramine (10147)
```
Botcommand: addindex 359759812 Tienopramine
```
```
For index : Tienopramine=359759812
```
* 37967-98-9 -> 37967-98-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tienopramine not found on commonchemistry - Tienopramine

* ChemSpiderID: 188026 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 216992

* No InChI - (ChemSpider: | InChI=InChI=1/C17H20N2S/c1-18(2)11-5-12-19-15-7-4-3-6-14(15)8-9-17-16(19)10-13-20-17/h3-4,6-10,13H,5,11-12H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=s1ccc2N(c3c(\C=C/c12)cccc3)CCCN(C)C )
Tiflorex (10148)
File:(Â±)-Tiflorex Structural Formulae.svg
```
Botcommand: addindex 357238119 Tiflorex
```
```
For index : Tiflorex=357238119
```
* 53993-67-2 -> 53993-67-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiflorex not found on commonchemistry - Tiflorex

* No ChemSpiderID

* PubChem: 173669

* No InChI

* No SMILES
Tifluadom (10149)
```
Botcommand: addindex 360228530 Tifluadom
```
```
For index : Tifluadom=360228530
```
* 83386-35-0 -> 83386-35-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tifluadom not found on commonchemistry - Tifluadom

* No ChemSpiderID

* PubChem: 115208

* No InChI

* No SMILES
Tigatuzumab (10150)
```
Botcommand: addindex 354151656 Tigatuzumab
```
```
For index : Tigatuzumab=354151656
```
* 918127-53-4 -> 918127-53-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tigatuzumab not found on commonchemistry - Tigatuzumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

10151 to 10200

Tigemonam (10152)

* No CASNo

* Tigemonam not found on commonchemistry - Tigemonam

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tiglic_acid (10153)
```
Botcommand: addindex 323471533 Tiglic_acid
```
```
For index : Tiglic_acid=323471533
```
* 80-59-1 -> 80-59-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiglic+acid not found on commonchemistry - Tiglic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC=C(C)C(=O)O
Tiglyl-CoA (10154)

* No CASNo

* Tiglyl+CoA not found on commonchemistry - Tiglyl+CoA

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tilbroquinol (10155)
```
Botcommand: addindex 346985085 Tilbroquinol
```
```
For index : Tilbroquinol=346985085
```
* 7175-09-9 -> 7175-09-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tilbroquinol not found on commonchemistry - Tilbroquinol

* No ChemSpiderID

* PubChem: 65592

* No InChI

* No SMILES
Tiletamine (10156)

* No CASNo

* Tiletamine not found on commonchemistry - Tiletamine

* No ChemSpiderID

* PubChem: 26533

* No InChI

* No SMILES
Tilidine (10157)
```
Botcommand: addindex 349594891 Tilidine
```
```
For index : Tilidine=349594891
```
* 51931-66-9 -> 51931-66-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tilidine not found on commonchemistry - Tilidine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tilisolol (10158)
```
Botcommand: addindex 351660920 Tilisolol
```
```
For index : Tilisolol=351660920
```
* 85136-71-6 -> 85136-71-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tilisolol not found on commonchemistry - Tilisolol

* No ChemSpiderID

* PubChem: 5474

* No InChI

* No SMILES
Tilomisole (10159)
```
Botcommand: addindex 362390067 Tilomisole
```
```
For index : Tilomisole=362390067
```
* 58433-11-7 -> 58433-11-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tilomisole not found on commonchemistry - Tilomisole

* ChemSpiderID: 38987 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 42747

* InChI: InChI=1S/C17H11ClN2O2S/c18-11-7-5-10(6-8-11)16-14(9-15(21)22)23-17-19-12-3-1-2-4-13(12)20(16)17/h1-8H,9H2,(H,21,22) - (ChemSpider: | InChI=InChI=1/C17H11ClN2O2S/c18-11-7-5-10(6-8-11)16-14(9-15(21)22)23-17-19-12-3-1-2-4-13(12)20(16)17/h1-8H,9H2,(H,21,22) )

* SMILES: Clc4ccc(c1c(sc2nc3ccccc3n12)CC(=O)O)cc4 - (ChemSpider: | SMILES=Clc4ccc(c1c(sc2nc3ccccc3n12)CC(=O)O)cc4 )
Tilorone (10160)
```
Botcommand: addindex 355914963 Tilorone
```
```
For index : Tilorone=355914963
```
* 27591-97-5 -> 27591-97-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tilorone not found on commonchemistry - Tilorone

* No ChemSpiderID

* PubChem: 5475

* No InChI

* No SMILES
Timepidium_bromide (10162)
```
Botcommand: addindex 348545601 Timepidium_bromide
```
```
For index : Timepidium_bromide=348545601
```
* 35035-05-3 -> 35035-05-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Timepidium+bromide not found on commonchemistry - Timepidium+bromide

* No ChemSpiderID

* PubChem: 160243

* No InChI

* No SMILES
Timiperone (10163)
```
Botcommand: addindex 356138494 Timiperone
```
```
For index : Timiperone=356138494
```
* 57648-21-2 -> 57648-21-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Timiperone not found on commonchemistry - Timiperone

* No ChemSpiderID

* PubChem: 3033151

* No InChI

* No SMILES
Tin(II)_bromide (10168)
File:Tin(II) bromide.jpg
```
Botcommand: addindex 359000785 Tin(II)_bromide
```
```
For index : Tin(II)_bromide=359000785
```
* 10031-24-0 -> 10031-24-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+II+bromide not found on commonchemistry - Tin+II+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(II)_hydroxide (10171)
```
Botcommand: addindex 308479729 Tin(II)_hydroxide
```
```
For index : Tin(II)_hydroxide=308479729
```
* 12026-24-3 -> 12026-24-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+II+hydroxide not found on commonchemistry - Tin+II+hydroxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(II)_iodide (10172)
```
Botcommand: addindex 352815185 Tin(II)_iodide
```
```
For index : Tin(II)_iodide=352815185
```
* 10294-70-9 -> 10294-70-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+II+iodide not found on commonchemistry - Tin+II+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(IV)_bromide (10176)
```
Botcommand: addindex 296376307 Tin(IV)_bromide
```
```
For index : Tin(IV)_bromide=296376307
```
* 7789-67-5 -> 7789-67-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+IV+bromide not found on commonchemistry - Tin+IV+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(IV)_fluoride (10178)
```
Botcommand: addindex 306722733 Tin(IV)_fluoride
```
```
For index : Tin(IV)_fluoride=306722733
```
* 7783-62-2 -> 7783-62-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+IV+fluoride not found on commonchemistry - Tin+IV+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(IV)_iodide (10179)

* No CASNo

* Tin+IV+iodide not found on commonchemistry - Tin+IV+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tin(IV)_sulfide (10180)
```
Botcommand: addindex 321092644 Tin(IV)_sulfide
```
```
For index : Tin(IV)_sulfide=321092644
```
* 1315-01-1 -> 1315-01-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tin+IV+sulfide not found on commonchemistry - Tin+IV+sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tinyatoxin (10182)
```
Botcommand: addindex 355253221 Tinyatoxin
```
```
For index : Tinyatoxin=355253221
```
* 58821-95-7 -> 58821-95-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tinyatoxin not found on commonchemistry - Tinyatoxin

* No ChemSpiderID

* PubChem: 442098

* No InChI

* No SMILES
Tinzaparin_sodium (10183)
```
Botcommand: addindex 362231148 Tinzaparin_sodium
```
```
For index : Tinzaparin_sodium=362231148
```
* 9005-49-6 -> 9005-49-6 - NOT VERIFIED

* CAS found on commonchemistry - 9005-49-6 - name not in list
All names: Ardeparin, Arteven, Bemiparin, Centaxarin, Certoparin, Clevarin, Clivarin, Clivarine, CY 216, CY 222, Dalteparin, Deligoparin, Fluxum, FR 860, Fragmin A, Fragmin B, Fraxiparin, Gammaparin, H 5284, H 9399, Hapacarin, Heparin, Heparin subcutan, Heparin sulfate, heparina, Heparine, Heparinic acid, KB 101, Leparan, Livaracine, M 118REH, Mono-embolex, Multiparin, Nadroparin, Nadroparine, Novoheparin, Octaparin, OP 386, OP 622, Pabyrn, Parnaparin, Parvoparin, Reviparin, Sandoparin, Subeparin, Sublingula, Tinzaparin, Triofiban, Vetren, Vitrum AB, Î±-Heparin

* Tinzaparin+sodium found on commonchemistry - Tinzaparin+sodium
* 9041-08-1 (exact match)
Name in list

All names: Alfa 87-120, Alfa 87-163, Alfa 87-198, Alfa 87-81, Alfa 88-247, Ardeparin sodium, Badyket, Bemiparin sodium, Clivarin 1750, Dalteparin sodium, Deligoparin sodium, Depo-Heparin, Fragmin, Fragmin IV, H 2149, Hed-Heparin, Hepaflush, Hepagumin, Hepalean, Heparin Fragment Kabi 2165, Heparin sodium, Heparin, sodium salt, Heparine, sel de sodium, HEPARIN-NATRIUM, Hepathrom, Heprinar, Hepsal, Inno-Hep, Ivor, Kabi 2165, LHN 1, Lioton 1000, Lipo-Hepin, Lipo-Hepinette, Liquaemin sodium, Liquemin, Logiparin, Longheparin, Minihep, Minolteparin sodium, Monoparin, Nadroparine sodium, Normiflo, OP 2000, Panheprin, Parnaparin sodium, Pularin, Reviparin sodium, RO 11, RP 54563, Sodium acid heparin, Sodium heparin, Sodium heparinate, Sodium parnaparin, Thrombo-Hepin, Thromboliquine, [[tinzaparin sodium]], Unihep, Viatromb, WY 90493RD, Zibor

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tioclomarol (10184)

* No CASNo

* Tioclomarol not found on commonchemistry - Tioclomarol

* No ChemSpiderID

* PubChem: 72147

* No InChI

* No SMILES
Tiomesterone (10187)
```
Botcommand: addindex 307981023 Tiomesterone
```
```
For index : Tiomesterone=307981023
```
* 2205-73-4 -> 2205-73-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiomesterone not found on commonchemistry - Tiomesterone

* No ChemSpiderID

* PubChem: 16626

* No InChI

* SMILES: CC(=O)S[C@@H]1CC2=CC(=O)C[C@@H]([C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C)O)C)SC(=O)C
Tiopronin (10188)
```
Botcommand: addindex 338430552 Tiopronin
```
```
For index : Tiopronin=338430552
```
* 1953-02-2 -> 1953-02-2 - NOT VERIFIED

* CAS found on commonchemistry - 1953-02-2 - name in list
All names: (.+-.)-Tiopronin, (2-Mercaptopropionamido)acetic acid, (2-Mercaptopropionyl)glycine, Acadione, BRN 1859822, Capen, Captimer, CCRIS 1935, DL-(Î±-Mercaptopropionyl)glycine, Epatiol, Glycine, N-(2-mercapto-1-oxopropyl)-, Glycine, N-(2-mercaptopropionyl)-, Hepadigest, Meprin, Meprin (detoxicant), Mercaptopropionylglycine, MPG, MPG (hepatoprotective), Mucolysin, N-(2-Mercapto-1-oxopropyl)glycine, N-(2-Mercaptopropionyl)glycine, N-(Î±-Mercaptopropionyl) glycine, Sutilan, Sutilan Cusi, Thiola, Thiolpropionamidoacetic acid, Thiopronin, Thiopronine, Thiosol, Tioglis, tiopronin, Tiopronine, tiopronine, tiopronino, Tiopronino, Tioproninum, Vincol, Î±-Mercaptopropionyglycine, Î±-Mercaptopropionylglycine

* Tiopronin found on commonchemistry - Tiopronin
* 1953-02-2 (exact match) Matches CAS (1953-02-2) on page
Name in list

All names: [[(.+-.)-tiopronin]], (2-Mercaptopropionamido)acetic acid, (2-Mercaptopropionyl)glycine, Acadione, BRN 1859822, Capen, Captimer, CCRIS 1935, DL-(Î±-Mercaptopropionyl)glycine, Epatiol, Glycine, N-(2-mercapto-1-oxopropyl)-, Glycine, N-(2-mercaptopropionyl)-, Hepadigest, Meprin, Meprin (detoxicant), Mercaptopropionylglycine, MPG, MPG (hepatoprotective), Mucolysin, N-(2-Mercapto-1-oxopropyl)glycine, N-(2-Mercaptopropionyl)glycine, N-(Î±-Mercaptopropionyl) glycine, Sutilan, Sutilan Cusi, Thiola, Thiolpropionamidoacetic acid, Thiopronin, Thiopronine, Thiosol, Tioglis, [[tiopronin]], [[tiopronine]], [[tiopronine]], [[tiopronino]], [[tiopronino]], [[tioproninum]], Vincol, Î±-Mercaptopropionyglycine, Î±-Mercaptopropionylglycine

* No ChemSpiderID

* PubChem: 5483

* No InChI

* No SMILES
Tiospirone (10189)
```
Botcommand: addindex 360221375 Tiospirone
```
```
For index : Tiospirone=360221375
```
* 87691-91-6 -> 87691-91-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiospirone not found on commonchemistry - Tiospirone

* ChemSpiderID: 50348 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 55752

* No InChI - (ChemSpider: | InChI=InChI=1/C24H32N4O2S/c29-21-17-24(9-3-4-10-24)18-22(30)28(21)12-6-5-11-26-13-15-27(16-14-26)23-19-7-1-2-8-20(19)31-25-23/h1-2,7-8H,3-6,9-18H2 )

* No SMILES - (ChemSpider: | smiles=O=C1N(C(=O)CC2(C1)CCCC2)CCCCN5CCN(c4nsc3ccccc34)CC5 )
Tiotropium (10190)
File:Tiotropium.png
```
Botcommand: addindex 364210889 Tiotropium
```
```
For index : Tiotropium=364210889
```
* 186691-13-4 -> 186691-13-4 - NOT VERIFIED

* CAS found on commonchemistry - 186691-13-4 - name not in list
All names: [[3-Oxa-9-azoniatricyclo[3.3.1.02,4]nonane, 7-[(hydroxydi-2-thienylacetyl)oxy]-9,9-dimethyl-, (1Î±,2Î²,4Î²,5Î±,7Î²)-]]

* Tiotropium not found on commonchemistry - Tiotropium

* No ChemSpiderID

* PubChem: 131950

* No InChI

* No SMILES
Tioxolone (10191)
```
Botcommand: addindex 319319201 Tioxolone
```
```
For index : Tioxolone=319319201
```
* 4991-65-5^{[citation needed]}  ->  4991-65-5  - NOT VERIFIED

* The CAS number '4991-65-5^{[citation needed]} ' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Tioxolone not found on commonchemistry - Tioxolone

* No ChemSpiderID

* PubChem: 72139

* No InChI

* SMILES: C1=CC2=C(C=C1O)OC(=O)S2
Tipepidine (10192)
```
Botcommand: addindex 349557338 Tipepidine
```
```
For index : Tipepidine=349557338
```
* 5169-78-8 -> 5169-78-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tipepidine not found on commonchemistry - Tipepidine

* No ChemSpiderID

* PubChem: 5484

* No InChI

* No SMILES
Tipifarnib (10193)
* No CASNo

* Tipifarnib not found on commonchemistry - Tipifarnib

* No ChemSpiderID

* PubChem: 148193

* No InChI

* No SMILES
Tiprolisant (10195)
```
Botcommand: addindex 347187387 Tiprolisant
```
```
For index : Tiprolisant=347187387
```
* 903576-44-3 -> 903576-44-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiprolisant not found on commonchemistry - Tiprolisant

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C2CCCCN2CCCOCCCc1ccc(Cl)cc1
Tiracizine (10196)
```
Botcommand: addindex 353552301 Tiracizine
```
```
For index : Tiracizine=353552301
```
* 78816-67-8 -> 78816-67-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiracizine not found on commonchemistry - Tiracizine

* No ChemSpiderID

* PubChem: 71264

* No InChI

* SMILES: CCOC(=O)NC1=CC2=C(CCC3=CC=CC=C3N2C(=O)CN(C)C)C=C1
Tirapazamine (10197)
```
Botcommand: addindex 313581537 Tirapazamine
```
```
For index : Tirapazamine=313581537
```
* 27314-97-2 -> 27314-97-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tirapazamine not found on commonchemistry - Tirapazamine

* No ChemSpiderID

* PubChem: 33776

* No InChI

* No SMILES
Tiratricol (10198)
```
Botcommand: addindex 350686719 Tiratricol
```
```
For index : Tiratricol=350686719
```
* 51-24-1 -> 51-24-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiratricol not found on commonchemistry - Tiratricol

* No ChemSpiderID

* PubChem: 5803

* No InChI

* No SMILES
Tirilazad (10199)
```
Botcommand: addindex 348480146 Tirilazad
```
```
For index : Tirilazad=348480146
```
* 110101-66-1 -> 110101-66-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tirilazad not found on commonchemistry - Tirilazad

* No ChemSpiderID

* PubChem: 104903

* No InChI

* No SMILES

10201 to 10250

Tiropramide (10201)
```
Botcommand: addindex 355908663 Tiropramide
```
```
For index : Tiropramide=355908663
```
* 55837-29-1 -> 55837-29-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tiropramide not found on commonchemistry - Tiropramide

* No ChemSpiderID

* PubChem: 42262

* No InChI

* No SMILES
Tisopurine (10202)
```
Botcommand: addindex 345311601 Tisopurine
```
```
For index : Tisopurine=345311601
```
* 5334-23-6 -> 5334-23-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tisopurine not found on commonchemistry - Tisopurine

* No ChemSpiderID

* PubChem: 667510

* No InChI

* No SMILES
Titanium_tetrabromide (10210)
```
Botcommand: addindex 364691384 Titanium_tetrabromide
```
```
For index : Titanium_tetrabromide=364691384
```
* 7789-68-6 -> 7789-68-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+tetrabromide not found on commonchemistry - Titanium+tetrabromide

* No ChemSpiderID

* PubChem: 123263

* No InChI

* No SMILES
Titanium_tetraiodide (10212)
```
Botcommand: addindex 292988392 Titanium_tetraiodide
```
```
For index : Titanium_tetraiodide=292988392
```
* 7720-83-4 -> 7720-83-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+tetraiodide not found on commonchemistry - Titanium+tetraiodide

* No ChemSpiderID

* PubChem: 111328

* No InChI

* No SMILES
Titanium(II)_chloride (10213)
```
Botcommand: addindex 292552812 Titanium(II)_chloride
```
```
For index : Titanium(II)_chloride=292552812
```
* 10049-06-6 -> 10049-06-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+II+chloride not found on commonchemistry - Titanium+II+chloride

* No ChemSpiderID

* PubChem: 66228

* No InChI

* No SMILES
Titanium(II)_sulfide (10215)
```
Botcommand: addindex 333570499 Titanium(II)_sulfide
```
```
For index : Titanium(II)_sulfide=333570499
```
* 12039-07-5 -> 12039-07-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+II+sulfide not found on commonchemistry - Titanium+II+sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Titanium(III)_fluoride (10217)
```
Botcommand: addindex 301333966 Titanium(III)_fluoride
```
```
For index : Titanium(III)_fluoride=301333966
```
* 13470-08-1 -> 13470-08-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+III+fluoride not found on commonchemistry - Titanium+III+fluoride

* No ChemSpiderID

* PubChem: 83506

* No InChI

* No SMILES
Titanium(III)_oxide (10218)
```
Botcommand: addindex 292989454 Titanium(III)_oxide
```
```
For index : Titanium(III)_oxide=292989454
```
* 1344-54-3 -> 1344-54-3 - NOT VERIFIED

* CAS found on commonchemistry - 1344-54-3 - name not in list
All names: C.I. 77892, dititanium trioxide, Dititantrioxid, TITANIUM (III) OXIDE (Ti2O3), Titanium III oxide, Titanium oxide (Ti2O3), Titanium oxide (TiO1.5), Titanium sesquioxide, trioxido de dititanio, Trioxyde de dititane

* Titanium+III+oxide found on commonchemistry - Titanium+III+oxide
* 1344-54-3 (exact match) Matches CAS (1344-54-3) on page
Name not in list

All names: C.I. 77892, dititanium trioxide, Dititantrioxid, TITANIUM (III) OXIDE (Ti2O3), [[titanium iii oxide]], Titanium oxide (Ti2O3), Titanium oxide (TiO1.5), Titanium sesquioxide, trioxido de dititanio, Trioxyde de dititane

* No ChemSpiderID

* PubChem: 123111

* No InChI

* No SMILES
Titanium(III)_phosphide (10219)
```
Botcommand: addindex 301193935 Titanium(III)_phosphide
```
```
For index : Titanium(III)_phosphide=301193935
```
* 12037-65-9 -> 12037-65-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+III+phosphide not found on commonchemistry - Titanium+III+phosphide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Titanium(IV)_fluoride (10220)
File:Titanium(IV) fluoride.jpg
```
Botcommand: addindex 292987615 Titanium(IV)_fluoride
```
```
For index : Titanium(IV)_fluoride=292987615
```
* 7783-63-3 -> 7783-63-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanium+IV+fluoride not found on commonchemistry - Titanium+IV+fluoride

* No ChemSpiderID

* PubChem: 121824

* No InChI

* No SMILES
Titanocene_dicarbonyl (10221)
```
Botcommand: addindex 354517402 Titanocene_dicarbonyl
```
```
For index : Titanocene_dicarbonyl=354517402
```
* 12129-51-0 -> 12129-51-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Titanocene+dicarbonyl not found on commonchemistry - Titanocene+dicarbonyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tixocortol (10223)
```
Botcommand: addindex 300287179 Tixocortol
```
```
For index : Tixocortol=300287179
```
* 61951-99-3 -> 61951-99-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tixocortol not found on commonchemistry - Tixocortol

* No ChemSpiderID

* PubChem: 162955

* No InChI

* No SMILES
Tixocortol_pivalate (10224)

* No CASNo

* Tixocortol+pivalate not found on commonchemistry - Tixocortol+pivalate

* No ChemSpiderID

* PubChem: 15052414

* No InChI

* SMILES: CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CSC(=O)C(C)(C)C)O)C)O
Tizoxanide (10226)
```
Botcommand: addindex 290083449 Tizoxanide
```
```
For index : Tizoxanide=290083449
```
* 173903-47-4 -> 173903-47-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tizoxanide not found on commonchemistry - Tizoxanide

* No ChemSpiderID

* PubChem: 394397

* No InChI

* SMILES: C1=CC=C(C(=C1)C(=O)NC2=NC=C(S2)[N+](=O)[O-])O
Tobradex (10227)
* No CASNo

* Tobradex not found on commonchemistry - Tobradex

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tobramycin (10228)
```
Botcommand: addindex 360070095 Tobramycin
```
```
For index : Tobramycin=360070095
```
* 32986-56-4 -> 32986-56-4 - NOT VERIFIED

* CAS found on commonchemistry - 32986-56-4 - name in list
All names: 3'-Deoxykanamycin B, Deoxykanamycin B, [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino- 2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-]], [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-]], Nebramycin 6, Nebramycin factor 6, Nebramycin VI, NF 6, NSC 180514, [[O-3-Amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’4)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’6)]-2-deoxystreptamine]], [[O-3-Amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-D-streptamine]], [[Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’4)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’6)]-2-deoxy-, D-]], Tobracin, Tobradistin, Tobralex, Tobramax, Tobramaxin, Tobramicin, tobramicina, Tobramycetin, tobramycin, tobramycine, Tobrex

* Tobramycin found on commonchemistry - Tobramycin
* 32986-56-4 (exact match) Matches CAS (32986-56-4) on page
Name in list

All names: 3'-Deoxykanamycin B, Deoxykanamycin B, [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino- 2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-]], [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-]], Nebramycin 6, Nebramycin factor 6, Nebramycin VI, NF 6, NSC 180514, [[O-3-Amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’4)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’6)]-2-deoxystreptamine]], [[O-3-Amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’4)]-2-deoxy-D-streptamine]], [[Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’4)-O-[2,6-diamino-2,3,6-trideoxy-Î±-D-ribo-hexopyranosyl-(1â†’6)]-2-deoxy-, D-]], Tobracin, Tobradistin, Tobralex, Tobramax, Tobramaxin, Tobramicin, tobramicina, Tobramycetin, [[tobramycin]], [[tobramycine]], Tobrex

* ChemSpiderID: 33377 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5496

* No InChI - (ChemSpider: | InChI=InChI=1/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O([C@@H]2[C@@H](O)[C@H](O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N)[C@@H](N)C[C@H]2N)[C@H]3O[C@@H]([C@@H](O)[C@H](N)[C@H]3O)CO )
Toceranib (10230)
File:Toceranib.png
```
Botcommand: addindex 362460168 Toceranib
```
```
For index : Toceranib=362460168
```
* 256068-94-5 -> 256068-94-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Toceranib not found on commonchemistry - Toceranib

* ChemSpiderID: 4486268 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 8034466

* No InChI - (ChemSpider: | InChI=InChI=1/C22H25FN4O2/c1-13-19(12-17-16-11-15(23)5-6-18(16)26-21(17)28)25-14(2)20(13)22(29)24-7-10-27-8-3-4-9-27/h5-6,11-12,25H,3-4,7-10H2,1-2H3,(H,24,29)(H,26,28)/b17-12- )

* No SMILES - (ChemSpider: | smiles=Fc1ccc2c(c1)/C(C(=O)N2)=C/c4c(c(C(=O)NCCN3CCCC3)c(n4)C)C )
Tocilizumab (10231)
```
Botcommand: addindex 350323859 Tocilizumab
```
```
For index : Tocilizumab=350323859
```
* 375823-41-9 -> 375823-41-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tocilizumab not found on commonchemistry - Tocilizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tocofersolan (10232)

* No CASNo

* Tocofersolan not found on commonchemistry - Tocofersolan

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tofisopam (10234)
```
Botcommand: addindex 362346712 Tofisopam
```
```
For index : Tofisopam=362346712
```
* 22345-47-7 -> 22345-47-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tofisopam not found on commonchemistry - Tofisopam

* No ChemSpiderID

* PubChem: 5502

* No InChI

* No SMILES
Tolciclate (10239)
```
Botcommand: addindex 273468598 Tolciclate
```
```
For index : Tolciclate=273468598
```
* 50838-36-3 -> 50838-36-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolciclate not found on commonchemistry - Tolciclate

* No ChemSpiderID

* PubChem: 5506

* No InChI

* No SMILES
Tolfenamic_acid (10241)
```
Botcommand: addindex 364720923 Tolfenamic_acid
```
```
For index : Tolfenamic_acid=364720923
```
* 13710-19-5 -> 13710-19-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolfenamic+acid not found on commonchemistry - Tolfenamic+acid

* No ChemSpiderID

* PubChem: 610479

* No InChI

* No SMILES
Tolgabide (10242)
```
Botcommand: addindex 356737218 Tolgabide
```
```
For index : Tolgabide=356737218
```
* 86914-11-6 -> 86914-11-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolgabide not found on commonchemistry - Tolgabide

* ChemSpiderID: 4678139 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5748792

* No InChI - (ChemSpider: | InChI=InChI=1/C18H18Cl2N2O2/c1-11-9-14(20)10-15(18(11)24)17(22-8-2-3-16(21)23)12-4-6-13(19)7-5-12/h4-7,9-10,22H,2-3,8H2,1H3,(H2,21,23)/b17-15- )

* No SMILES - (ChemSpider: | smiles=O=C2/C(=C\C(\Cl)=C/C2=C(/NCCCC(=O)N)c1ccc(Cl)cc1)C )
Tolidine (10243)
```
Botcommand: addindex 359000570 Tolidine
```
```
For index : Tolidine=359000570
```
* 119-93-7 -> 119-93-7 - NOT VERIFIED

* CAS found on commonchemistry - 119-93-7 - name in list
All names: [[[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-]], [[[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-]], [[[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-]], 3,3'-Dimethyl-(1,1'-biphenyl)-4,4'-diamine, 3,3'-Dimethyl-(1,1'-biphenyl)-4,4'-diamine, [[3,3'-Dimethyl-[(1,1'-biphenyl]-4,4'-diamine]], 3,3'-Dimethyl-4,4'-biphenyldiamine, 3,3'-Dimethyl-4,4'-diaminobiphenyl, 3,3'-Dimethylbenzidine, 3,3'-Dimethylbenzidine (o-tolidine), 3,3'-Tolidine, 4,4'-Bi-o-toluidin, 4,4'-bi-o-toluidina, 4,4'-Bi-o-toluidine, 4,4'-Diamino-3,3'-dimethyl-1,1'-biphenyl, 4,4'-Diamino-3,3'-dimethylbiphenyl, [[4'-Amino-3,3'-dimethyl[1,1'-biphenyl]-4-ylamine]], Benzidine, 3,3'-dimethyl-, Bianisidine, C.I. 37230, C.I. Azoic Diazo Component 113, Fast Dark Blue Base R, o,o'-Tolidine, Orthotolidine, O-TOLIDIN, o-Tolidine, UN 2811

* Tolidine found on commonchemistry - Tolidine
* 72-57-1 (Formula: C34H28N6O14S4.4Na; Name: 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[5-amino-4-hydroxy-, tetrasodium salt)

* 119-93-7 (Formula: C14H16N2; Name: [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-) Matches CAS (119-93-7) on page

* No ChemSpiderID

* PubChem: 8413

* No InChI

* SMILES: CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N
Tolimidone (10244)
```
Botcommand: addindex 361075931 Tolimidone
```
```
For index : Tolimidone=361075931
```
* 41964-07-2 -> 41964-07-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolimidone not found on commonchemistry - Tolimidone

* ChemSpiderID: 35751 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 39065

* No InChI - (ChemSpider: | InChI=InChI=1/C11H10N2O2/c1-8-3-2-4-9(5-8)15-10-6-12-11(14)13-7-10/h2-7H,1H3,(H,12,13,14) )

* No SMILES - (ChemSpider: | smiles=O=C2/N=C\C(\Oc1cc(ccc1)C)=C/N2 )
Tolonidine (10247)
```
Botcommand: addindex 347004354 Tolonidine
```
```
For index : Tolonidine=347004354
```
* 4201-22-3 -> 4201-22-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolonidine not found on commonchemistry - Tolonidine

* No ChemSpiderID

* PubChem: 72138

* No InChI

* SMILES: CC1=CC(=C(C=C1)NC2=NCCN2)Cl
Tolonium_chloride (10248)
```
Botcommand: addindex 365029649 Tolonium_chloride
```
```
For index : Tolonium_chloride=365029649
```
* 92-31-9 -> 92-31-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolonium+chloride not found on commonchemistry - Tolonium+chloride

* No ChemSpiderID

* PubChem: 7084

* No InChI

* SMILES: CC1=CC2=C(C=C1N)SC3= CC(=[N+](C)C)C=CC3=N2
Toloxatone (10249)
```
Botcommand: addindex 351217373 Toloxatone
```
```
For index : Toloxatone=351217373
```
* 29218-27-7 -> 29218-27-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Toloxatone not found on commonchemistry - Toloxatone

* No ChemSpiderID

* PubChem: 34521

* No InChI

* No SMILES
Tolperisone (10250)
```
Botcommand: addindex 345308492 Tolperisone
```
```
For index : Tolperisone=345308492
```
* 728-88-1 -> 728-88-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolperisone not found on commonchemistry - Tolperisone

* No ChemSpiderID

* PubChem: 5511

* No InChI

* No SMILES